C12H17FN2O3 — CID 139978521
(3S)-3-amino-5-(3-fluoro-4-methoxyphenyl)-N-hydroxypentanamide (PubChem CID 139978521) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is (3S)-3-amino-5-(3-fluoro-4-methoxyphenyl)-N-hydroxypentanamide.
| Compound Name | (3S)-3-amino-5-(3-fluoro-4-methoxyphenyl)-N-hydroxypentanamide |
|---|---|
| PubChem CID | 139978521 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3S)-3-amino-5-(3-fluoro-4-methoxyphenyl)-N-hydroxypentanamide |
| SMILES | COc1ccc(CC[C@H](N)CC(=O)NO)cc1F |
| InChI | InChI=1S/C12H17FN2O3/c1-18-11-5-3-8(6-10(11)13)2-4-9(14)7-12(16)15-17/h3,5-6,9,17H,2,4,7,14H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | YLMUXPOFXURMCS-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|