C10H12FNO4 — CID 71721752
3-(3-fluoro-4-methoxyphenyl)-N,3-dihydroxypropanamide (PubChem CID 71721752) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-N,3-dihydroxypropanamide.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-N,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 71721752 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-N,3-dihydroxypropanamide |
| SMILES | COc1ccc(C(O)CC(=O)NO)cc1F |
| InChI | InChI=1S/C10H12FNO4/c1-16-9-3-2-6(4-7(9)11)8(13)5-10(14)12-15/h2-4,8,13,15H,5H2,1H3,(H,12,14) |
| InChIKey | YETGHWMIGCPCNJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|