C27H53NO5Si2 — CID 139979645
cyclohept-2-en-1-yl 4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]-4-oxobutanoate (PubChem CID 139979645) has the molecular formula C27H53NO5Si2 and a molecular weight of 527.90 g/mol. Its IUPAC name is cyclohept-2-en-1-yl 4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]-4-oxobutanoate.
| Compound Name | cyclohept-2-en-1-yl 4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 139979645 |
| Molecular Formula | C27H53NO5Si2 |
| Molecular Weight | 527.90 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | cyclohept-2-en-1-yl 4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]-4-oxobutanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)C(=O)CCC(=O)OC1C=CCCCC1 |
| InChI | InChI=1S/C27H53NO5Si2/c1-26(2,3)34(7,8)31-21-19-28(20-22-32-35(9,10)27(4,5)6)24(29)17-18-25(30)33-23-15-13-11-12-14-16-23/h13,15,23H,11-12,14,16-22H2,1-10H3 |
| InChIKey | ZZBJLWXGCQFJIH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.90 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|