C27H33N3O4 — CID 139980529
tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-[1-(3-phenylprop-2-enyl)indol-3-yl]propan-2-yl]carbamate (PubChem CID 139980529) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-[1-(3-phenylprop-2-enyl)indol-3-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-[1-(3-phenylprop-2-enyl)indol-3-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139980529 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | tert-butyl N-[(2R)-1-[methoxy(methyl)amino]-1-oxo-3-[1-(3-phenylprop-2-enyl)indol-3-yl]propan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@@H](Cc1cn(CC=Cc2ccccc2)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33N3O4/c1-27(2,3)34-26(32)28-23(25(31)29(4)33-5)18-21-19-30(24-16-10-9-15-22(21)24)17-11-14-20-12-7-6-8-13-20/h6-16,19,23H,17-18H2,1-5H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | BBLLKAJAGBZHBF-HSZRJFAPSA-N |
| XLogP | 4.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|