C24H35N3O5 — CID 178134933
tert-butyl 3-[1-(3-formamidopropyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 178134933) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl 3-[1-(3-formamidopropyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl 3-[1-(3-formamidopropyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 178134933 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl 3-[1-(3-formamidopropyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(CCCNC=O)c2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35N3O5/c1-23(2,3)31-21(29)19(26-22(30)32-24(4,5)6)14-17-15-27(13-9-12-25-16-28)20-11-8-7-10-18(17)20/h7-8,10-11,15-16,19H,9,12-14H2,1-6H3,(H,25,28)(H,26,30) |
| InChIKey | WZFPLEDLIXJXAV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|