About 2H-thieno[2,3-d]azepine 1-oxide
2H-thieno[2,3-d]azepine 1-oxide (PubChem CID 139981179) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 2H-thieno[2,3-d]azepine 1-oxide.
Molecular Properties
| Compound Name | 2H-thieno[2,3-d]azepine 1-oxide |
| PubChem CID | 139981179 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 2H-thieno[2,3-d]azepine 1-oxide |
| SMILES | O=S1CC=C2C=CN=CC=C21 |
| InChI | InChI=1S/C8H7NOS/c10-11-6-3-7-1-4-9-5-2-8(7)11/h1-5H,6H2 |
| InChIKey | PHHWNAFQGSUDME-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-thieno[2,3-d]azepine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-thieno[2,3-d]azepine 1-oxide?
The IUPAC name of 2H-thieno[2,3-d]azepine 1-oxide (CID 139981179) is 2H-thieno[2,3-d]azepine 1-oxide.
What is the SMILES notation for 2H-thieno[2,3-d]azepine 1-oxide?
The canonical SMILES for 2H-thieno[2,3-d]azepine 1-oxide is O=S1CC=C2C=CN=CC=C21.
What is the InChIKey of 2H-thieno[2,3-d]azepine 1-oxide?
The InChIKey is PHHWNAFQGSUDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-11-6-3-7-1-4-9-5-2-8(7)11/h1-5H,6H2.
What are the key properties of 2H-thieno[2,3-d]azepine 1-oxide?
2H-thieno[2,3-d]azepine 1-oxide has a molecular weight of 165.22 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-thieno[2,3-d]azepine 1-oxide is sourced from PubChem (CID 139981179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).