About 2H-thieno[2,3-d]azepine;dihydrochloride
2H-thieno[2,3-d]azepine;dihydrochloride (PubChem CID 172789909) has the molecular formula C8H9Cl2NS
and a molecular weight of 222.14 g/mol. Its IUPAC name is 2H-thieno[2,3-d]azepine;dihydrochloride.
Molecular Properties
| Compound Name | 2H-thieno[2,3-d]azepine;dihydrochloride |
| PubChem CID | 172789909 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 2H-thieno[2,3-d]azepine;dihydrochloride |
| SMILES | C1=CC2=CCSC2=CC=N1.Cl.Cl |
| InChI | InChI=1S/C8H7NS.2ClH/c1-4-9-5-2-8-7(1)3-6-10-8;;/h1-5H,6H2;2*1H |
| InChIKey | PKMMEGOFBRQXJT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-thieno[2,3-d]azepine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-thieno[2,3-d]azepine;dihydrochloride?
The IUPAC name of 2H-thieno[2,3-d]azepine;dihydrochloride (CID 172789909) is 2H-thieno[2,3-d]azepine;dihydrochloride.
What is the SMILES notation for 2H-thieno[2,3-d]azepine;dihydrochloride?
The canonical SMILES for 2H-thieno[2,3-d]azepine;dihydrochloride is C1=CC2=CCSC2=CC=N1.Cl.Cl.
What is the InChIKey of 2H-thieno[2,3-d]azepine;dihydrochloride?
The InChIKey is PKMMEGOFBRQXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.2ClH/c1-4-9-5-2-8-7(1)3-6-10-8;;/h1-5H,6H2;2*1H.
What are the key properties of 2H-thieno[2,3-d]azepine;dihydrochloride?
2H-thieno[2,3-d]azepine;dihydrochloride has a molecular weight of 222.14 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-thieno[2,3-d]azepine;dihydrochloride is sourced from PubChem (CID 172789909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).