C8H9Cl2NS — CID 162336078
2H-thieno[2,3-c]azepine;dihydrochloride (PubChem CID 162336078) has the molecular formula C8H9Cl2NS and a molecular weight of 222.14 g/mol. Its IUPAC name is 2H-thieno[2,3-c]azepine;dihydrochloride.
| Compound Name | 2H-thieno[2,3-c]azepine;dihydrochloride |
|---|---|
| PubChem CID | 162336078 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 2H-thieno[2,3-c]azepine;dihydrochloride |
| SMILES | C1=CC2=CCSC2=CN=C1.Cl.Cl |
| InChI | InChI=1S/C8H7NS.2ClH/c1-2-7-3-5-10-8(7)6-9-4-1;;/h1-4,6H,5H2;2*1H |
| InChIKey | LJYCXOWNOCYTHD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |