C23H31N3 — CID 139982521
2-[2-methyl-1-[[1-[(3-methylphenyl)methyl]piperidin-4-ylidene]amino]propyl]aniline (PubChem CID 139982521) has the molecular formula C23H31N3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-[2-methyl-1-[[1-[(3-methylphenyl)methyl]piperidin-4-ylidene]amino]propyl]aniline.
| Compound Name | 2-[2-methyl-1-[[1-[(3-methylphenyl)methyl]piperidin-4-ylidene]amino]propyl]aniline |
|---|---|
| PubChem CID | 139982521 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 2-[2-methyl-1-[[1-[(3-methylphenyl)methyl]piperidin-4-ylidene]amino]propyl]aniline |
| SMILES | Cc1cccc(CN2CCC(=NC(c3ccccc3N)C(C)C)CC2)c1 |
| InChI | InChI=1S/C23H31N3/c1-17(2)23(21-9-4-5-10-22(21)24)25-20-11-13-26(14-12-20)16-19-8-6-7-18(3)15-19/h4-10,15,17,23H,11-14,16,24H2,1-3H3 |
| InChIKey | KLFIDSDPCNTXPN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|