C26H26F3N3O — CID 139982487
2-[phenyl-[[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-ylidene]amino]methyl]aniline (PubChem CID 139982487) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[phenyl-[[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-ylidene]amino]methyl]aniline.
| Compound Name | 2-[phenyl-[[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-ylidene]amino]methyl]aniline |
|---|---|
| PubChem CID | 139982487 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-[phenyl-[[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-ylidene]amino]methyl]aniline |
| SMILES | Nc1ccccc1C(N=C1CCN(Cc2cccc(OC(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H26F3N3O/c27-26(28,29)33-22-10-6-7-19(17-22)18-32-15-13-21(14-16-32)31-25(20-8-2-1-3-9-20)23-11-4-5-12-24(23)30/h1-12,17,25H,13-16,18,30H2 |
| InChIKey | KDNHIXUZHFLZKR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|