C18H18N2O — CID 139985787
N-benzyl-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine (PubChem CID 139985787) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-benzyl-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine.
| Compound Name | N-benzyl-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine |
|---|---|
| PubChem CID | 139985787 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-benzyl-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenamine |
| SMILES | C(=C(NCc1ccccc1)c1ccccc1)C1=NCCO1 |
| InChI | InChI=1S/C18H18N2O/c1-3-7-15(8-4-1)14-20-17(13-18-19-11-12-21-18)16-9-5-2-6-10-16/h1-10,13,20H,11-12,14H2 |
| InChIKey | SDLZSXBDWKREAV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |