C12H24S4Si — CID 139986636
dimethyl-bis[2-(thiiran-2-ylmethylsulfanyl)ethyl]silane (PubChem CID 139986636) has the molecular formula C12H24S4Si and a molecular weight of 324.68 g/mol. Its IUPAC name is dimethyl-bis[2-(thiiran-2-ylmethylsulfanyl)ethyl]silane.
| Compound Name | dimethyl-bis[2-(thiiran-2-ylmethylsulfanyl)ethyl]silane |
|---|---|
| PubChem CID | 139986636 |
| Molecular Formula | C12H24S4Si |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | dimethyl-bis[2-(thiiran-2-ylmethylsulfanyl)ethyl]silane |
| SMILES | C[Si](C)(CCSCC1CS1)CCSCC1CS1 |
| InChI | InChI=1S/C12H24S4Si/c1-17(2,5-3-13-7-11-9-15-11)6-4-14-8-12-10-16-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | MGOLNMUYWDBMBA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|