C10H16S8 — CID 71416065
2,5-bis(thiiran-2-ylmethyldisulfanyl)-1,4-dithiane (PubChem CID 71416065) has the molecular formula C10H16S8 and a molecular weight of 392.77 g/mol. Its IUPAC name is 2,5-bis(thiiran-2-ylmethyldisulfanyl)-1,4-dithiane.
| Compound Name | 2,5-bis(thiiran-2-ylmethyldisulfanyl)-1,4-dithiane |
|---|---|
| PubChem CID | 71416065 |
| Molecular Formula | C10H16S8 |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 2,5-bis(thiiran-2-ylmethyldisulfanyl)-1,4-dithiane |
| SMILES | C(SSC1CSC(SSCC2CS2)CS1)C1CS1 |
| InChI | InChI=1S/C10H16S8/c1-7(11-1)3-15-17-9-5-14-10(6-13-9)18-16-4-8-2-12-8/h7-10H,1-6H2 |
| InChIKey | QXCPIMWQWQSYKR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|