C12H20S6 — CID 87569266
2,5-bis(thietan-2-ylsulfanylmethyl)-1,4-dithiane (PubChem CID 87569266) has the molecular formula C12H20S6 and a molecular weight of 356.69 g/mol. Its IUPAC name is 2,5-bis(thietan-2-ylsulfanylmethyl)-1,4-dithiane.
| Compound Name | 2,5-bis(thietan-2-ylsulfanylmethyl)-1,4-dithiane |
|---|---|
| PubChem CID | 87569266 |
| Molecular Formula | C12H20S6 |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2,5-bis(thietan-2-ylsulfanylmethyl)-1,4-dithiane |
| SMILES | C1CC(SCC2CSC(CSC3CCS3)CS2)S1 |
| InChI | InChI=1S/C12H20S6/c1-3-13-11(1)17-7-9-5-16-10(6-15-9)8-18-12-2-4-14-12/h9-12H,1-8H2 |
| InChIKey | NFTIXHSKEDZTPZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |