C9H14S4Se2 — CID 87188336
2-[[5-(thiiran-2-ylmethylsulfanyl)-1,3-diselenolan-4-yl]sulfanylmethyl]thiirane (PubChem CID 87188336) has the molecular formula C9H14S4Se2 and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-[[5-(thiiran-2-ylmethylsulfanyl)-1,3-diselenolan-4-yl]sulfanylmethyl]thiirane.
| Compound Name | 2-[[5-(thiiran-2-ylmethylsulfanyl)-1,3-diselenolan-4-yl]sulfanylmethyl]thiirane |
|---|---|
| PubChem CID | 87188336 |
| Molecular Formula | C9H14S4Se2 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 409.83 |
| IUPAC Name | 2-[[5-(thiiran-2-ylmethylsulfanyl)-1,3-diselenolan-4-yl]sulfanylmethyl]thiirane |
| SMILES | C1[Se]C(SCC2CS2)C(SCC2CS2)[Se]1 |
| InChI | InChI=1S/C9H14S4Se2/c1-6(10-1)3-12-8-9(15-5-14-8)13-4-7-2-11-7/h6-9H,1-5H2 |
| InChIKey | QNRYDQYEZBNAFI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|