C8H14S4 — CID 146197998
2-(thietan-3-ylsulfanylmethyl)-1,4-dithiane (PubChem CID 146197998) has the molecular formula C8H14S4 and a molecular weight of 238.47 g/mol. Its IUPAC name is 2-(thietan-3-ylsulfanylmethyl)-1,4-dithiane.
| Compound Name | 2-(thietan-3-ylsulfanylmethyl)-1,4-dithiane |
|---|---|
| PubChem CID | 146197998 |
| Molecular Formula | C8H14S4 |
| Molecular Weight | 238.47 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2-(thietan-3-ylsulfanylmethyl)-1,4-dithiane |
| SMILES | C1CSC(CSC2CSC2)CS1 |
| InChI | InChI=1S/C8H14S4/c1-2-11-8(3-9-1)6-12-7-4-10-5-7/h7-8H,1-6H2 |
| InChIKey | KGMXZMXHDMGNIM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |