C11H18S6 — CID 87568216
2,2-bis(thietan-3-ylsulfanylmethyl)-1,3-dithiolane (PubChem CID 87568216) has the molecular formula C11H18S6 and a molecular weight of 342.67 g/mol. Its IUPAC name is 2,2-bis(thietan-3-ylsulfanylmethyl)-1,3-dithiolane.
| Compound Name | 2,2-bis(thietan-3-ylsulfanylmethyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 87568216 |
| Molecular Formula | C11H18S6 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2,2-bis(thietan-3-ylsulfanylmethyl)-1,3-dithiolane |
| SMILES | C1CSC(CSC2CSC2)(CSC2CSC2)S1 |
| InChI | InChI=1S/C11H18S6/c1-2-17-11(16-1,7-14-9-3-12-4-9)8-15-10-5-13-6-10/h9-10H,1-8H2 |
| InChIKey | MTGGDOPFAMHBKF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |