C5H9NS4 — CID 143739617
2-(thietan-3-ylsulfanyl)-1,3,2-dithiazolidine (PubChem CID 143739617) has the molecular formula C5H9NS4 and a molecular weight of 211.40 g/mol. Its IUPAC name is 2-(thietan-3-ylsulfanyl)-1,3,2-dithiazolidine.
| Compound Name | 2-(thietan-3-ylsulfanyl)-1,3,2-dithiazolidine |
|---|---|
| PubChem CID | 143739617 |
| Molecular Formula | C5H9NS4 |
| Molecular Weight | 211.40 g/mol |
| Exact Mass | 210.96 |
| IUPAC Name | 2-(thietan-3-ylsulfanyl)-1,3,2-dithiazolidine |
| SMILES | C1CSN(SC2CSC2)S1 |
| InChI | InChI=1S/C5H9NS4/c1-2-9-6(8-1)10-5-3-7-4-5/h5H,1-4H2 |
| InChIKey | OVSKDRUYMMUALR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|