C9H14OS4 — CID 141069543
3,3-bis(thietan-3-ylsulfanyl)propanal (PubChem CID 141069543) has the molecular formula C9H14OS4 and a molecular weight of 266.48 g/mol. Its IUPAC name is 3,3-bis(thietan-3-ylsulfanyl)propanal.
| Compound Name | 3,3-bis(thietan-3-ylsulfanyl)propanal |
|---|---|
| PubChem CID | 141069543 |
| Molecular Formula | C9H14OS4 |
| Molecular Weight | 266.48 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 3,3-bis(thietan-3-ylsulfanyl)propanal |
| SMILES | O=CCC(SC1CSC1)SC1CSC1 |
| InChI | InChI=1S/C9H14OS4/c10-2-1-9(13-7-3-11-4-7)14-8-5-12-6-8/h2,7-9H,1,3-6H2 |
| InChIKey | RDOMOUASUARXMA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|