About azane;3,3-dichloropropanal
azane;3,3-dichloropropanal (PubChem CID 88605523) has the molecular formula C3H7Cl2NO
and a molecular weight of 144.00 g/mol. Its IUPAC name is azane;3,3-dichloropropanal.
Molecular Properties
| Compound Name | azane;3,3-dichloropropanal |
| PubChem CID | 88605523 |
| Molecular Formula | C3H7Cl2NO |
| Molecular Weight | 144.00 g/mol |
| Exact Mass | 142.99 |
| IUPAC Name | azane;3,3-dichloropropanal |
| SMILES | N.O=CCC(Cl)Cl |
| InChI | InChI=1S/C3H4Cl2O.H3N/c4-3(5)1-2-6;/h2-3H,1H2;1H3 |
| InChIKey | RYPHQKDHYRQQIS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.00 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;3,3-dichloropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,3-dichloropropanal?
The IUPAC name of azane;3,3-dichloropropanal (CID 88605523) is azane;3,3-dichloropropanal.
What is the SMILES notation for azane;3,3-dichloropropanal?
The canonical SMILES for azane;3,3-dichloropropanal is N.O=CCC(Cl)Cl.
What is the InChIKey of azane;3,3-dichloropropanal?
The InChIKey is RYPHQKDHYRQQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Cl2O.H3N/c4-3(5)1-2-6;/h2-3H,1H2;1H3.
What are the key properties of azane;3,3-dichloropropanal?
azane;3,3-dichloropropanal has a molecular weight of 144.00 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,3-dichloropropanal is sourced from PubChem (CID 88605523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).