About 3,5-dichloropentanal
3,5-dichloropentanal (PubChem CID 18670684) has the molecular formula C5H8Cl2O
and a molecular weight of 155.02 g/mol. Its IUPAC name is 3,5-dichloropentanal.
Molecular Properties
| Compound Name | 3,5-dichloropentanal |
| PubChem CID | 18670684 |
| Molecular Formula | C5H8Cl2O |
| Molecular Weight | 155.02 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 3,5-dichloropentanal |
| SMILES | O=CCC(Cl)CCCl |
| InChI | InChI=1S/C5H8Cl2O/c6-3-1-5(7)2-4-8/h4-5H,1-3H2 |
| InChIKey | JMRHWBJCRBECDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.02 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloropentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloropentanal?
The IUPAC name of 3,5-dichloropentanal (CID 18670684) is 3,5-dichloropentanal.
What is the SMILES notation for 3,5-dichloropentanal?
The canonical SMILES for 3,5-dichloropentanal is O=CCC(Cl)CCCl.
What is the InChIKey of 3,5-dichloropentanal?
The InChIKey is JMRHWBJCRBECDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Cl2O/c6-3-1-5(7)2-4-8/h4-5H,1-3H2.
What are the key properties of 3,5-dichloropentanal?
3,5-dichloropentanal has a molecular weight of 155.02 g/mol, XLogP of 1.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloropentanal is sourced from PubChem (CID 18670684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).