About 4-Chloro-2-iodobutanal
4-Chloro-2-iodobutanal (PubChem CID 19782770) has the molecular formula C4H6ClIO
and a molecular weight of 232.45 g/mol. Its IUPAC name is 4-chloro-2-iodobutanal.
Molecular Properties
| Compound Name | 4-Chloro-2-iodobutanal |
| PubChem CID | 19782770 |
| Molecular Formula | C4H6ClIO |
| Molecular Weight | 232.45 g/mol |
| Exact Mass | 231.92 |
| IUPAC Name | 4-chloro-2-iodobutanal |
| SMILES | C(CCl)C(C=O)I |
| InChI | InChI=1S/C4H6ClIO/c5-2-1-4(6)3-7/h3-4H,1-2H2 |
| InChIKey | OCMJNQVCEHPIJG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | 57 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-Chloro-2-iodobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Chloro-2-iodobutanal?
The IUPAC name of 4-Chloro-2-iodobutanal (CID 19782770) is 4-chloro-2-iodobutanal.
What is the SMILES notation for 4-Chloro-2-iodobutanal?
The canonical SMILES for 4-Chloro-2-iodobutanal is C(CCl)C(C=O)I.
What is the InChIKey of 4-Chloro-2-iodobutanal?
The InChIKey is OCMJNQVCEHPIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClIO/c5-2-1-4(6)3-7/h3-4H,1-2H2.
What are the key properties of 4-Chloro-2-iodobutanal?
4-Chloro-2-iodobutanal has a molecular weight of 232.45 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Chloro-2-iodobutanal is sourced from PubChem (CID 19782770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).