C4H8Cl2O4S — CID 19787422
2,4-dichlorobutanal;sulfurous acid (PubChem CID 19787422) has the molecular formula C4H8Cl2O4S and a molecular weight of 223.08 g/mol. Its IUPAC name is 2,4-dichlorobutanal;sulfurous acid.
| Compound Name | 2,4-dichlorobutanal;sulfurous acid |
|---|---|
| PubChem CID | 19787422 |
| Molecular Formula | C4H8Cl2O4S |
| Molecular Weight | 223.08 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 2,4-dichlorobutanal;sulfurous acid |
| SMILES | O=CC(Cl)CCCl.O=S(O)O |
| InChI | InChI=1S/C4H6Cl2O.H2O3S/c5-2-1-4(6)3-7;1-4(2)3/h3-4H,1-2H2;(H2,1,2,3) |
| InChIKey | CZBOLBGXBMHEPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.08 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|