C44H30ClN5 — CID 139986817
8-chloro-23-(2-methyl-4-pyridinyl)-10,12,13-triphenyl-21H-porphyrin (PubChem CID 139986817) has the molecular formula C44H30ClN5 and a molecular weight of 664.21 g/mol. Its IUPAC name is 8-chloro-23-(2-methyl-4-pyridinyl)-10,12,13-triphenyl-21H-porphyrin.
| Compound Name | 8-chloro-23-(2-methyl-4-pyridinyl)-10,12,13-triphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 139986817 |
| Molecular Formula | C44H30ClN5 |
| Molecular Weight | 664.21 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 8-chloro-23-(2-methyl-4-pyridinyl)-10,12,13-triphenyl-21H-porphyrin |
| SMILES | Cc1cc(-n2c3cc4nc(cc5ccc(cc6nc(c(-c7ccccc7)c2c(-c2ccccc2)c3-c2ccccc2)C(Cl)=C6)[nH]5)C=C4)ccn1 |
| InChI | InChI=1S/C44H30ClN5/c1-28-23-37(21-22-46-28)50-39-27-35-20-19-33(48-35)24-32-17-18-34(47-32)25-36-26-38(45)43(49-36)42(31-15-9-4-10-16-31)44(50)41(30-13-7-3-8-14-30)40(39)29-11-5-2-6-12-29/h2-27,47H,1H3/b32-24-,33-24-,34-25-,35-27-,36-25-,39-27-,43-42-,44-42- |
| InChIKey | BYFGFKVWIXIRNB-KKDSKCRHSA-N |
| XLogP | 11.39 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.21 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |