C20H38O6 — CID 139989233
dipropyl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate (PubChem CID 139989233) has the molecular formula C20H38O6 and a molecular weight of 374.52 g/mol. Its IUPAC name is dipropyl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate.
| Compound Name | dipropyl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate |
|---|---|
| PubChem CID | 139989233 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | dipropyl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate |
| SMILES | CCCOC(=O)C(CC)(OC(C)C)C(CC)(OC(C)C)C(=O)OCCC |
| InChI | InChI=1S/C20H38O6/c1-9-13-23-17(21)19(11-3,25-15(5)6)20(12-4,26-16(7)8)18(22)24-14-10-2/h15-16H,9-14H2,1-8H3 |
| InChIKey | KCJIXGPWGURQJP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |