C20H38O6 — CID 139989251
dipropan-2-yl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate (PubChem CID 139989251) has the molecular formula C20H38O6 and a molecular weight of 374.52 g/mol. Its IUPAC name is dipropan-2-yl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate.
| Compound Name | dipropan-2-yl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate |
|---|---|
| PubChem CID | 139989251 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | dipropan-2-yl 2,3-diethyl-2,3-di(propan-2-yloxy)butanedioate |
| SMILES | CCC(OC(C)C)(C(=O)OC(C)C)C(CC)(OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C20H38O6/c1-11-19(25-15(7)8,17(21)23-13(3)4)20(12-2,26-16(9)10)18(22)24-14(5)6/h13-16H,11-12H2,1-10H3 |
| InChIKey | GANOPSYLCSDOBT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |