C56H94O4Sr — CID 139989805
strontium bis(2,2,3,3-tetracyclohexylbutanoate) (PubChem CID 139989805) has the molecular formula C56H94O4Sr and a molecular weight of 918.98 g/mol. Its IUPAC name is strontium bis(2,2,3,3-tetracyclohexylbutanoate).
| Compound Name | strontium bis(2,2,3,3-tetracyclohexylbutanoate) |
|---|---|
| PubChem CID | 139989805 |
| Molecular Formula | C56H94O4Sr |
| Molecular Weight | 918.98 g/mol |
| Exact Mass | 918.62 |
| IUPAC Name | strontium bis(2,2,3,3-tetracyclohexylbutanoate) |
| SMILES | CC(C1CCCCC1)(C1CCCCC1)C(C(=O)[O-])(C1CCCCC1)C1CCCCC1.CC(C1CCCCC1)(C1CCCCC1)C(C(=O)[O-])(C1CCCCC1)C1CCCCC1.[Sr+2] |
| InChI | InChI=1S/2C28H48O2.Sr/c2*1-27(22-14-6-2-7-15-22,23-16-8-3-9-17-23)28(26(29)30,24-18-10-4-11-19-24)25-20-12-5-13-21-25;/h2*22-25H,2-21H2,1H3,(H,29,30);/q;;+2/p-2 |
| InChIKey | CCNKHMYFTSAXPE-UHFFFAOYSA-L |
| XLogP | 13.72 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.98 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |