C15H19Cl2N3O2 — CID 139990454
2-[(2,4-dichlorophenyl)-(4-propyl-1,3-dioxolan-2-yl)methyl]-1,3-dihydro-1,2,4-triazole (PubChem CID 139990454) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)-(4-propyl-1,3-dioxolan-2-yl)methyl]-1,3-dihydro-1,2,4-triazole.
| Compound Name | 2-[(2,4-dichlorophenyl)-(4-propyl-1,3-dioxolan-2-yl)methyl]-1,3-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 139990454 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)-(4-propyl-1,3-dioxolan-2-yl)methyl]-1,3-dihydro-1,2,4-triazole |
| SMILES | CCCC1COC(C(c2ccc(Cl)cc2Cl)N2CN=CN2)O1 |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-2-3-11-7-21-15(22-11)14(20-9-18-8-19-20)12-5-4-10(16)6-13(12)17/h4-6,8,11,14-15H,2-3,7,9H2,1H3,(H,18,19) |
| InChIKey | RQLIPBGYKQHSJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |