C29H24N2O5 — CID 139992545
2-[3,5-bis(4-aminophenoxy)phenyl]-7-methoxy-3-methylchromen-4-one (PubChem CID 139992545) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[3,5-bis(4-aminophenoxy)phenyl]-7-methoxy-3-methylchromen-4-one.
| Compound Name | 2-[3,5-bis(4-aminophenoxy)phenyl]-7-methoxy-3-methylchromen-4-one |
|---|---|
| PubChem CID | 139992545 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[3,5-bis(4-aminophenoxy)phenyl]-7-methoxy-3-methylchromen-4-one |
| SMILES | COc1ccc2c(=O)c(C)c(-c3cc(Oc4ccc(N)cc4)cc(Oc4ccc(N)cc4)c3)oc2c1 |
| InChI | InChI=1S/C29H24N2O5/c1-17-28(32)26-12-11-23(33-2)16-27(26)36-29(17)18-13-24(34-21-7-3-19(30)4-8-21)15-25(14-18)35-22-9-5-20(31)6-10-22/h3-16H,30-31H2,1-2H3 |
| InChIKey | RTUBRZSYNGQKNP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|