C28H21FN2O4 — CID 139992892
2-[3,5-bis(4-aminophenoxy)phenyl]-6-fluoro-3-methylchromen-4-one (PubChem CID 139992892) has the molecular formula C28H21FN2O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[3,5-bis(4-aminophenoxy)phenyl]-6-fluoro-3-methylchromen-4-one.
| Compound Name | 2-[3,5-bis(4-aminophenoxy)phenyl]-6-fluoro-3-methylchromen-4-one |
|---|---|
| PubChem CID | 139992892 |
| Molecular Formula | C28H21FN2O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[3,5-bis(4-aminophenoxy)phenyl]-6-fluoro-3-methylchromen-4-one |
| SMILES | Cc1c(-c2cc(Oc3ccc(N)cc3)cc(Oc3ccc(N)cc3)c2)oc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C28H21FN2O4/c1-16-27(32)25-14-18(29)2-11-26(25)35-28(16)17-12-23(33-21-7-3-19(30)4-8-21)15-24(13-17)34-22-9-5-20(31)6-10-22/h2-15H,30-31H2,1H3 |
| InChIKey | BJSSYRFQFDXERR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|