C23H22BrF3O3 — CID 139992609
6-(6-bromohexoxy)-3-methyl-2-[4-(trifluoromethyl)phenyl]chromen-4-one (PubChem CID 139992609) has the molecular formula C23H22BrF3O3 and a molecular weight of 483.32 g/mol. Its IUPAC name is 6-(6-bromohexoxy)-3-methyl-2-[4-(trifluoromethyl)phenyl]chromen-4-one.
| Compound Name | 6-(6-bromohexoxy)-3-methyl-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 139992609 |
| Molecular Formula | C23H22BrF3O3 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 6-(6-bromohexoxy)-3-methyl-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)cc2)oc2ccc(OCCCCCCBr)cc2c1=O |
| InChI | InChI=1S/C23H22BrF3O3/c1-15-21(28)19-14-18(29-13-5-3-2-4-12-24)10-11-20(19)30-22(15)16-6-8-17(9-7-16)23(25,26)27/h6-11,14H,2-5,12-13H2,1H3 |
| InChIKey | HUDAWFZMYIXVET-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|