C29H27F3N2O5 — CID 139992709
6-[4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate (PubChem CID 139992709) has the molecular formula C29H27F3N2O5 and a molecular weight of 540.54 g/mol. Its IUPAC name is 6-[4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate.
| Compound Name | 6-[4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 139992709 |
| Molecular Formula | C29H27F3N2O5 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 6-[4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCOc2ccc3c(=O)cc(-c4ccc(C(F)(F)F)cc4)oc3c2)c1 |
| InChI | InChI=1S/C29H27F3N2O5/c30-29(31,32)20-7-5-18(6-8-20)26-17-25(35)24-10-9-23(16-27(24)39-26)37-11-3-1-2-4-12-38-28(36)19-13-21(33)15-22(34)14-19/h5-10,13-17H,1-4,11-12,33-34H2 |
| InChIKey | QCVHMPNJACSHOM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|