C30H29F3N2O5 — CID 139992536
6-[3-methyl-4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate (PubChem CID 139992536) has the molecular formula C30H29F3N2O5 and a molecular weight of 554.57 g/mol. Its IUPAC name is 6-[3-methyl-4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate.
| Compound Name | 6-[3-methyl-4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 139992536 |
| Molecular Formula | C30H29F3N2O5 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 6-[3-methyl-4-oxo-2-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyhexyl 3,5-diaminobenzoate |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)cc2)oc2cc(OCCCCCCOC(=O)c3cc(N)cc(N)c3)ccc2c1=O |
| InChI | InChI=1S/C30H29F3N2O5/c1-18-27(36)25-11-10-24(17-26(25)40-28(18)19-6-8-21(9-7-19)30(31,32)33)38-12-4-2-3-5-13-39-29(37)20-14-22(34)16-23(35)15-20/h6-11,14-17H,2-5,12-13,34-35H2,1H3 |
| InChIKey | KZMCTSZBPZIRGL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|