C22H15F3N2O3 — CID 139992880
6-(2,5-diaminophenoxy)-2-[4-(trifluoromethyl)phenyl]chromen-4-one (PubChem CID 139992880) has the molecular formula C22H15F3N2O3 and a molecular weight of 412.37 g/mol. Its IUPAC name is 6-(2,5-diaminophenoxy)-2-[4-(trifluoromethyl)phenyl]chromen-4-one.
| Compound Name | 6-(2,5-diaminophenoxy)-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 139992880 |
| Molecular Formula | C22H15F3N2O3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 6-(2,5-diaminophenoxy)-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
| SMILES | Nc1ccc(N)c(Oc2ccc3oc(-c4ccc(C(F)(F)F)cc4)cc(=O)c3c2)c1 |
| InChI | InChI=1S/C22H15F3N2O3/c23-22(24,25)13-3-1-12(2-4-13)20-11-18(28)16-10-15(6-8-19(16)30-20)29-21-9-14(26)5-7-17(21)27/h1-11H,26-27H2 |
| InChIKey | AIACCDYRXVJUJG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|