C16H18N2O3S — CID 139994195
O-ethyl 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]ethanethioate (PubChem CID 139994195) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is O-ethyl 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]ethanethioate.
| Compound Name | O-ethyl 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]ethanethioate |
|---|---|
| PubChem CID | 139994195 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | O-ethyl 2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]ethanethioate |
| SMILES | CCOC(=S)Cc1ncc(-c2ccc(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C16H18N2O3S/c1-4-21-16(22)8-15-17-9-12(10-18-15)11-5-6-13(19-2)14(7-11)20-3/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | ZEMQYAUJFVLJMH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|