C21H29N — CID 139994372
N-butyl-1-[2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phenyl]ethanimine (PubChem CID 139994372) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is N-butyl-1-[2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phenyl]ethanimine.
| Compound Name | N-butyl-1-[2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 139994372 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-butyl-1-[2-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phenyl]ethanimine |
| SMILES | CCCC/N=C(\C)c1ccccc1C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C21H29N/c1-7-8-13-22-18(6)19-11-9-10-12-20(19)21-16(4)14(2)15(3)17(21)5/h9-12,21H,7-8,13H2,1-6H3/b22-18+ |
| InChIKey | OIEQBQSFRUHQIG-RELWKKBWSA-N |
| XLogP | 6.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|