C14H13F5N2O3 — CID 14011342
N-[[(5S)-2-oxo-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 14011342) has the molecular formula C14H13F5N2O3 and a molecular weight of 352.26 g/mol. Its IUPAC name is N-[[(5S)-2-oxo-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-2-oxo-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 14011342 |
| Molecular Formula | C14H13F5N2O3 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[[(5S)-2-oxo-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(C(F)(F)C(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C14H13F5N2O3/c1-8(22)20-6-11-7-21(12(23)24-11)10-4-2-9(3-5-10)13(15,16)14(17,18)19/h2-5,11H,6-7H2,1H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | QHVRTQXPALTLAV-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|