C19H20FN3O3S — CID 14023658
1-ethyl-6-fluoro-4-oxo-7-[2-(propylaminomethyl)-1,3-thiazol-4-yl]quinoline-3-carboxylic acid (PubChem CID 14023658) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-4-oxo-7-[2-(propylaminomethyl)-1,3-thiazol-4-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-4-oxo-7-[2-(propylaminomethyl)-1,3-thiazol-4-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14023658 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-[2-(propylaminomethyl)-1,3-thiazol-4-yl]quinoline-3-carboxylic acid |
| SMILES | CCCNCc1nc(-c2cc3c(cc2F)c(=O)c(C(=O)O)cn3CC)cs1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-3-5-21-8-17-22-15(10-27-17)11-7-16-12(6-14(11)20)18(24)13(19(25)26)9-23(16)4-2/h6-7,9-10,21H,3-5,8H2,1-2H3,(H,25,26) |
| InChIKey | HWDSHYSCPYDXDX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|