About cesium bis(trimethylsilyl)azanide
cesium bis(trimethylsilyl)azanide (PubChem CID 14024633) has the molecular formula C6H18CsNSi2
and a molecular weight of 293.29 g/mol. Its IUPAC name is cesium bis(trimethylsilyl)azanide.
Molecular Properties
| Compound Name | cesium bis(trimethylsilyl)azanide |
| PubChem CID | 14024633 |
| Molecular Formula | C6H18CsNSi2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | cesium bis(trimethylsilyl)azanide |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Cs+] |
| InChI | InChI=1S/C6H18NSi2.Cs/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | RHCKAZZDNDQWHY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cesium bis(trimethylsilyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium bis(trimethylsilyl)azanide?
The IUPAC name of cesium bis(trimethylsilyl)azanide (CID 14024633) is cesium bis(trimethylsilyl)azanide.
What is the SMILES notation for cesium bis(trimethylsilyl)azanide?
The canonical SMILES for cesium bis(trimethylsilyl)azanide is C[Si](C)(C)[N-][Si](C)(C)C.[Cs+].
What is the InChIKey of cesium bis(trimethylsilyl)azanide?
The InChIKey is RHCKAZZDNDQWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18NSi2.Cs/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1.
What are the key properties of cesium bis(trimethylsilyl)azanide?
cesium bis(trimethylsilyl)azanide has a molecular weight of 293.29 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cesium bis(trimethylsilyl)azanide is sourced from PubChem (CID 14024633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).