potassium bis(trimethylsilyl)azanide

C6H18KNSi2 — CID 3251421

IUPACpotassium bis(trimethylsilyl)azanide
SMILESC[Si](C)(C)[N-][Si](C)(C)C.[K+]
InChIInChI=1S/C6H18NSi2.K/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1
InChIKeyIUBQJLUDMLPAGT-UHFFFAOYSA-N
MW199.49 g/mol
LogP0.03
Rot. Bonds2

About potassium bis(trimethylsilyl)azanide

potassium bis(trimethylsilyl)azanide (PubChem CID 3251421) has the molecular formula C6H18KNSi2 and a molecular weight of 199.49 g/mol. Its IUPAC name is potassium bis(trimethylsilyl)azanide.

Molecular Properties

Compound Namepotassium bis(trimethylsilyl)azanide
PubChem CID3251421
Molecular FormulaC6H18KNSi2
Molecular Weight199.49 g/mol
Exact Mass199.06
IUPAC Namepotassium bis(trimethylsilyl)azanide
SMILESC[Si](C)(C)[N-][Si](C)(C)C.[K+]
InChIInChI=1S/C6H18NSi2.K/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1
InChIKeyIUBQJLUDMLPAGT-UHFFFAOYSA-N
XLogP0.03
TPSA14.10 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.49
LogP ≤ 50.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium bis(trimethylsilyl)azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium bis(trimethylsilyl)azanide?
The IUPAC name of potassium bis(trimethylsilyl)azanide (CID 3251421) is potassium bis(trimethylsilyl)azanide.
What is the SMILES notation for potassium bis(trimethylsilyl)azanide?
The canonical SMILES for potassium bis(trimethylsilyl)azanide is C[Si](C)(C)[N-][Si](C)(C)C.[K+].
What is the InChIKey of potassium bis(trimethylsilyl)azanide?
The InChIKey is IUBQJLUDMLPAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18NSi2.K/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1.
What are the key properties of potassium bis(trimethylsilyl)azanide?
potassium bis(trimethylsilyl)azanide has a molecular weight of 199.49 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium bis(trimethylsilyl)azanide is sourced from PubChem (CID 3251421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).