C17H20O — CID 14024881
2-[(1S,2R)-2-prop-2-enoxycyclohexyl]ethynylbenzene (PubChem CID 14024881) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[(1S,2R)-2-prop-2-enoxycyclohexyl]ethynylbenzene.
| Compound Name | 2-[(1S,2R)-2-prop-2-enoxycyclohexyl]ethynylbenzene |
|---|---|
| PubChem CID | 14024881 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-[(1S,2R)-2-prop-2-enoxycyclohexyl]ethynylbenzene |
| SMILES | C=CCO[C@@H]1CCCC[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-2-14-18-17-11-7-6-10-16(17)13-12-15-8-4-3-5-9-15/h2-5,8-9,16-17H,1,6-7,10-11,14H2/t16-,17+/m0/s1 |
| InChIKey | YUELFJGUCXLFJP-DLBZAZTESA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|