C13H20N2O2 — CID 14025266
3-butyl-1-(2-hydroxy-4-methylphenyl)-1-methylurea (PubChem CID 14025266) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-butyl-1-(2-hydroxy-4-methylphenyl)-1-methylurea.
| Compound Name | 3-butyl-1-(2-hydroxy-4-methylphenyl)-1-methylurea |
|---|---|
| PubChem CID | 14025266 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-butyl-1-(2-hydroxy-4-methylphenyl)-1-methylurea |
| SMILES | CCCCNC(=O)N(C)c1ccc(C)cc1O |
| InChI | InChI=1S/C13H20N2O2/c1-4-5-8-14-13(17)15(3)11-7-6-10(2)9-12(11)16/h6-7,9,16H,4-5,8H2,1-3H3,(H,14,17) |
| InChIKey | PYLKRUDEKFRULX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|