About methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate
methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate (PubChem CID 14030167) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate.
Molecular Properties
| Compound Name | methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate |
| PubChem CID | 14030167 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate |
| SMILES | CN[C@@H](C(=O)OC)[C@@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H15NO5/c1-12-9(11(16)17-2)10(15)6-3-4-7(13)8(14)5-6/h3-5,9-10,12-15H,1-2H3/t9-,10+/m1/s1 |
| InChIKey | QUJHJYHGERRQOF-ZJUUUORDSA-N |
| XLogP | -0.11 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate?
The IUPAC name of methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate (CID 14030167) is methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate.
What is the SMILES notation for methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate?
The canonical SMILES for methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate is CN[C@@H](C(=O)OC)[C@@H](O)c1ccc(O)c(O)c1.
What is the InChIKey of methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate?
The InChIKey is QUJHJYHGERRQOF-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H15NO5/c1-12-9(11(16)17-2)10(15)6-3-4-7(13)8(14)5-6/h3-5,9-10,12-15H,1-2H3/t9-,10+/m1/s1.
What are the key properties of methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate?
methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate has a molecular weight of 241.24 g/mol, XLogP of -0.11, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate is sourced from PubChem (CID 14030167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).