C13H19NO5 — CID 139661090
propan-2-yl (2S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate (PubChem CID 139661090) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is propan-2-yl (2S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate.
| Compound Name | propan-2-yl (2S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 139661090 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | propan-2-yl (2S)-3-(3,4-dihydroxyphenyl)-3-hydroxy-2-(methylamino)propanoate |
| SMILES | CN[C@H](C(=O)OC(C)C)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H19NO5/c1-7(2)19-13(18)11(14-3)12(17)8-4-5-9(15)10(16)6-8/h4-7,11-12,14-17H,1-3H3/t11-,12?/m0/s1 |
| InChIKey | YIKVNYWOHVNNDG-PXYINDEMSA-N |
| XLogP | 0.67 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|