C18H24NO3+ — CID 1403402
(1S,12R,13R)-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-13-ol (PubChem CID 1403402) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is (1S,12R,13R)-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-13-ol.
| Compound Name | (1S,12R,13R)-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-13-ol |
|---|---|
| PubChem CID | 1403402 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (1S,12R,13R)-9-methoxy-4,4-dimethyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-13-ol |
| SMILES | COc1ccc2c3c1O[C@H]1[C@H](O)CC=C[C@@]31CC[N+](C)(C)C2 |
| InChI | InChI=1S/C18H24NO3/c1-19(2)10-9-18-8-4-5-13(20)17(18)22-16-14(21-3)7-6-12(11-19)15(16)18/h4,6-8,13,17,20H,5,9-11H2,1-3H3/q+1/t13-,17+,18-/m1/s1 |
| InChIKey | DOUIWWHBJPGSBE-JEBQAFNWSA-N |
| XLogP | 1.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|