C18H24N3+ — CID 1403669
3-(1,3-dimethylpyrido[3,4-b]indol-9-yl)propyl-dimethylazanium (PubChem CID 1403669) has the molecular formula C18H24N3+ and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrido[3,4-b]indol-9-yl)propyl-dimethylazanium.
| Compound Name | 3-(1,3-dimethylpyrido[3,4-b]indol-9-yl)propyl-dimethylazanium |
|---|---|
| PubChem CID | 1403669 |
| Molecular Formula | C18H24N3+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 3-(1,3-dimethylpyrido[3,4-b]indol-9-yl)propyl-dimethylazanium |
| SMILES | Cc1cc2c3ccccc3n(CCC[NH+](C)C)c2c(C)n1 |
| InChI | InChI=1S/C18H23N3/c1-13-12-16-15-8-5-6-9-17(15)21(11-7-10-20(3)4)18(16)14(2)19-13/h5-6,8-9,12H,7,10-11H2,1-4H3/p+1 |
| InChIKey | LHEQMTCMJWEKGO-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 22.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |