C29H36N4 — CID 46849930
N,N-diethyl-3-[[1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-3-yl]methylideneamino]propan-1-amine (PubChem CID 46849930) has the molecular formula C29H36N4 and a molecular weight of 440.64 g/mol. Its IUPAC name is N,N-diethyl-3-[[1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-3-yl]methylideneamino]propan-1-amine.
| Compound Name | N,N-diethyl-3-[[1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-3-yl]methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 46849930 |
| Molecular Formula | C29H36N4 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N,N-diethyl-3-[[1-methyl-9-(3-phenylpropyl)pyrido[3,4-b]indol-3-yl]methylideneamino]propan-1-amine |
| SMILES | CCN(CC)CCC/N=C/c1cc2c3ccccc3n(CCCc3ccccc3)c2c(C)n1 |
| InChI | InChI=1S/C29H36N4/c1-4-32(5-2)19-12-18-30-22-25-21-27-26-16-9-10-17-28(26)33(29(27)23(3)31-25)20-11-15-24-13-7-6-8-14-24/h6-10,13-14,16-17,21-22H,4-5,11-12,15,18-20H2,1-3H3/b30-22+ |
| InChIKey | GMMNTTCGFBUAHQ-JBASAIQMSA-N |
| XLogP | 6.28 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|