C25H23N5O — CID 175422602
3-[(E)-(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 175422602) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[(E)-(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one.
| Compound Name | 3-[(E)-(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 175422602 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-[(E)-(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | CCCCn1c2ccccc2c2cc(/C=N/N=C3C(=O)Nc4ccccc43)nc(C)c21 |
| InChI | InChI=1S/C25H23N5O/c1-3-4-13-30-22-12-8-6-9-18(22)20-14-17(27-16(2)24(20)30)15-26-29-23-19-10-5-7-11-21(19)28-25(23)31/h5-12,14-15H,3-4,13H2,1-2H3,(H,28,29,31)/b26-15+ |
| InChIKey | DEKXHKUHOVSZKX-CVKSISIWSA-N |
| XLogP | 5.07 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|