C24H36N4 — CID 46848429
N-[(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 46848429) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is N-[(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 46848429 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | N-[(9-butyl-1-methylpyrido[3,4-b]indol-3-yl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCCCn1c2ccccc2c2cc(CNCCCN(CC)CC)nc(C)c21 |
| InChI | InChI=1S/C24H36N4/c1-5-8-16-28-23-13-10-9-12-21(23)22-17-20(26-19(4)24(22)28)18-25-14-11-15-27(6-2)7-3/h9-10,12-13,17,25H,5-8,11,14-16,18H2,1-4H3 |
| InChIKey | KWUVPIYMCMURJB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|