C23H35ClN4 — CID 56666856
N-[(9-butylpyrido[3,4-b]indol-1-yl)methyl]-N',N'-diethylpropane-1,3-diamine;hydrochloride (PubChem CID 56666856) has the molecular formula C23H35ClN4 and a molecular weight of 403.01 g/mol. Its IUPAC name is N-[(9-butylpyrido[3,4-b]indol-1-yl)methyl]-N',N'-diethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-[(9-butylpyrido[3,4-b]indol-1-yl)methyl]-N',N'-diethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 56666856 |
| Molecular Formula | C23H35ClN4 |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N-[(9-butylpyrido[3,4-b]indol-1-yl)methyl]-N',N'-diethylpropane-1,3-diamine;hydrochloride |
| SMILES | CCCCn1c2ccccc2c2ccnc(CNCCCN(CC)CC)c21.Cl |
| InChI | InChI=1S/C23H34N4.ClH/c1-4-7-17-27-22-12-9-8-11-19(22)20-13-15-25-21(23(20)27)18-24-14-10-16-26(5-2)6-3;/h8-9,11-13,15,24H,4-7,10,14,16-18H2,1-3H3;1H |
| InChIKey | IMVXOCKHHOEEBR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|